|
|
| | Boc-Asp-OH-15N Basic information |
| Product Name: | Boc-Asp-OH-15N | | Synonyms: | L-ASPARTIC ACID-N-T-BOC (15N);L-ASPARTIC-15N ACID, N-T-BOC DERIVATIVE;L-Aspartic-15N acid, N-t-Boc derivative, N-(tert-Butoxycarbonyl)-L-aspartic acid-15N;"L-Aspartic Acid-15N, N-Boc";Boc-Asp-OH-15N;L-Aspartic acid-??-??-Boc (1?N, 98%);Boc-Asp-OH-15N | | CAS: | 204523-15-9 | | MF: | C9H15NO6 | | MW: | 234.23 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Boc-Asp-OH-15N Chemical Properties |
| Melting point | 116-118 °C(lit.) | | form | solid | | Optical Rotation | [α]20/D -7.3°, c =2 in DMF | | Major Application | peptide synthesis | | InChI | 1S/C9H15NO6/c1-9(2,3)16-8(15)10-5(7(13)14)4-6(11)12/h5H,4H2,1-3H3,(H,10,15)(H,11,12)(H,13,14)/t5-/m0/s1/i10+1 | | InChIKey | KAJBMCZQVSQJDE-PYWYPUIGSA-N | | SMILES | CC(C)(C)OC(=O)[15NH][C@@H](CC(O)=O)C(O)=O | | CAS Number Unlabeled | 13726-67-5 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids |
| | Boc-Asp-OH-15N Usage And Synthesis |
| | Boc-Asp-OH-15N Preparation Products And Raw materials |
|