| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
| Company Name: |
Novachemistry |
| Tel: |
44-20819178-90 02081917890 |
| Email: |
info@novachemistry.com |
|
| | pimprinine Basic information |
| Product Name: | pimprinine | | Synonyms: | 5-(3-Indolyl)-2-Methyloxazole, WS 30581C, APHE 3;5-(1H-Indol-3-yl)-2-Methyloxazole;1H-Indole, 3-(2-methyl-5-oxazolyl)-;Pimprinine >=98% (HPLC);APHE-3 | | CAS: | 13640-26-1 | | MF: | C12H10N2O | | MW: | 198.22 | | EINECS: | | | Product Categories: | | | Mol File: | 13640-26-1.mol |  |
| | pimprinine Chemical Properties |
| Melting point | 213.5 °C (polymorph) | | Boiling point | 407.8±28.0 °C(Predicted) | | density | 1.243±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: soluble; DMSO: soluble; Ethanol: soluble; Methanol: soluble | | form | Tan powder. | | pka | 15.78±0.30(Predicted) | | color | Pale yellow | | InChI | 1S/C12H10N2O/c1-8-13-7-12(15-8)10-6-14-11-5-3-2-4-9(10)11/h2-7,14H,1H3 | | InChIKey | WZJPGCHCOHYLMB-UHFFFAOYSA-N | | SMILES | [nH]1c2c(c(c1)c3[o]c(nc3)C)cccc2 |
| WGK Germany | WGK 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | pimprinine Usage And Synthesis |
| Uses | Pimprinine is an indole alkaloid produced by many species of Streptomyces. Pimprinine is a potent inhibitor of monoamine oxidase. More recently, pimprinine showed promising anticonvulsant activity in electric seizure threshold tests in mice, comparable to phenylhydantoin. Pimprinine also inhibits tremorine-induced tremors and analgesia in mice. | | Biological Activity | Pimprinine is an indole alkaloid extracted from Streptomyces species th at exhibits anticonvulsant activity. Pimprinine is a potent MAO inhibitor. Also, Pimprinine effectively inhibits replication of enterovirus 71 (EV71) and adenovirus 7 (ADV-7). | | storage | +4°C |
| | pimprinine Preparation Products And Raw materials |
|