- NQ301
-
- $53.00
-
2026-07-14
- CAS:130089-98-4
- Purity: 99.76%
- Supply Ability: 10g
|
| Product Name: | NQ301 | | Synonyms: | NQ301;NQ301 - Compound 211;NQ 301; NQ-301;2-((4-acetylphenyl)amino)-3-chloronaphthalene-1,4-dione;2-(4-Acetylanilino)-3-chloronaphthalene-1,4-dione;2-[(4-Acetylphenyl)amino]-3-chloro-1,4-naphthalenedione;1,4-Naphthalenedione, 2-[(4-acetylphenyl)amino]-3-chloro-;NQ301 >=98% (HPLC) | | CAS: | 130089-98-4 | | MF: | C18H12ClNO3 | | MW: | 325.75 | | EINECS: | | | Product Categories: | | | Mol File: | 130089-98-4.mol |  |
| | NQ301 Chemical Properties |
| Melting point | 241-243 °C(Solv: ethanol (64-17-5)) | | Boiling point | 476.8±45.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO:10.0(Max Conc. mg/mL);30.7(Max Conc. mM) | | form | powder | | pka | -5.25±0.20(Predicted) | | color | faint red to dark red | | InChI | 1S/C18H12ClNO3/c1-10(21)11-6-8-12(9-7-11)20-16-15(19)17(22)13-4-2-3-5-14(13)18(16)23/h2-9,20H,1H3 | | InChIKey | LSQZKIQSQHZVQS-UHFFFAOYSA-N | | SMILES | O=C1C(Cl)=C(NC2=CC=C(C(C)=O)C=C2)C(C3=CC=CC=C31)=O |
| RIDADR | UN 3077 9 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | NQ301 Usage And Synthesis |
| Uses | NQ 301 possess antiplatelet effect, making it an antithrombotic agent. It significantly inhibited the collagen-, thrombin-, arachidonic acid-, thapsigargin- and calcium ionophore A23187-induced aggregation of washed human platelets. | | Biochem/physiol Actions | NQ301 is an antithrombotic agent. Recent study shows that NQ301 (Compound 211) is a highly potent, selective, non-competitive allosteric inhibitor of CD45 that selectively inhibits dephosphorylation of substrate Lck pY-505 versus Lck pY-393. NQ301 prevents T cell receptor-mediated activation of Lck, Zap-70 and MAPK, and IL-2 production in primary T-cells. NQ301 exhibits immunosuppressive activity in mice. |
| | NQ301 Preparation Products And Raw materials |
|