| Company Name: |
commedx Gold |
| Tel: |
1851900025 |
| Email: |
zhanghu@commedx.com |
(p-SCN-Bn)-NOTA manufacturers
- NOTA-p-NCS-Bn
-
-
2025-06-07
- CAS:147597-66-8
- Min. Order: 100mg
- Purity: >98.00%
- Supply Ability: 100mg
|
| | (p-SCN-Bn)-NOTA Basic information |
| Product Name: | (p-SCN-Bn)-NOTA | | Synonyms: | NOTA-Bn-NCS;2-(ρ-Isothiocyanatobenzyl)-1,4,7-triazacyclononane- -N,N',N,"-triacetic acid trihydrochloride;2-(4-isothiocyanatobenzyl)-1,4,7-triazacyclononane-1,4,7-triacetic acid;p-SCN-Bn-NOTA(B-605);(p-SCN-Bn)-NOTA;2-S-(4-Aminobenzyl)-1, 4, 7-triazacyclononane-1, 4, 7-triacetic acid;1H-1,4,7-Triazonine-1,4,7-triacetic acid, hexahydro-2-[(4-isothiocyanatophenyl)methyl]-;NOTA-p-NCS-Bn | | CAS: | 147597-66-8 | | MF: | C20H26N4O6S | | MW: | 450.51 | | EINECS: | | | Product Categories: | | | Mol File: | 147597-66-8.mol |  |
| | (p-SCN-Bn)-NOTA Chemical Properties |
| Boiling point | 716.5±60.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | pka | 2.12±0.10(Predicted) | | InChI | InChI=1S/C20H26N4O6S/c25-18(26)11-22-5-6-23(12-19(27)28)10-17(24(8-7-22)13-20(29)30)9-15-1-3-16(4-2-15)21-14-31/h1-4,17H,5-13H2,(H,25,26)(H,27,28)(H,29,30) | | InChIKey | ABEIJMWLNYUWMD-UHFFFAOYSA-N | | SMILES | N1(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC1CC1=CC=C(N=C=S)C=C1 |
| | (p-SCN-Bn)-NOTA Usage And Synthesis |
| Uses | Modifications with bifunctional chelating agents (BFCA) like S-2-(4-isothiocyanatobenzyl)-1,4,7- triazacyclononane-1,4,7-triacetic acid( (p-SCN-Bn)-NOTA) allow the incorporation of radiometals for SPECT/PET-diagnostic (67Ga, 68Ga, 111In) or therapeutic (90Y) purposes.[1] | | References |
[1] NATHALIE BRACKE. Analytical characterization of NOTA-modified somatropins[J]. Journal of pharmaceutical and biomedical analysis, 2014, 96: Pages 1-9. DOI:10.1016/j.jpba.2014.03.014.
|
| | (p-SCN-Bn)-NOTA Preparation Products And Raw materials |
|