| Company Name: |
Combio (Suzhou) Ltd. Gold |
| Tel: |
17751201929; 17751201929 |
| Email: |
jianyang_yu@combiosz.com |
DO3AM-acetic acid manufacturers
- DOTA-(CONH2)3
-
-
2025-06-07
- CAS:913528-04-8
- Min. Order: 500mg
- Purity: >95.00%
- Supply Ability: 500mg
|
| | DO3AM-acetic acid Basic information |
| Product Name: | DO3AM-acetic acid | | Synonyms: | DO3AM-acetic acid;1,4,7,10-Tetraazacyclododecane-1-acetic acid, 4,7,10-tris(2-amino-2-oxoethyl)-;DOTA-(CONH2)3;2-(4,7,10-Tris(2-amino-2-oxoethyl)-1,4,7,10-tetraazacyclododecan-1-yl)acetic acid;DOTA(Triamide)-OH/DOTAM-mono-acid;Gadobutrol Impurity 156;2-(4,7,10-Tris(2-amino-2-oxoethyl)-1,4,7,10-tetraazacyclododecane-1-yl)acetic acid;DOTAM-mono-acid | | CAS: | 913528-04-8 | | MF: | C16H31N7O5 | | MW: | 401.46 | | EINECS: | | | Product Categories: | RDC Linker | | Mol File: | 913528-04-8.mol |  |
| | DO3AM-acetic acid Chemical Properties |
| form | Solid | | color | White to off-white | | InChI | InChI=1S/C16H31N7O5/c17-13(24)9-20-1-3-21(10-14(18)25)5-7-23(12-16(27)28)8-6-22(4-2-20)11-15(19)26/h1-12H2,(H2,17,24)(H2,18,25)(H2,19,26)(H,27,28) | | InChIKey | DFPHZEYJGWLQJE-UHFFFAOYSA-N | | SMILES | N1(CC(O)=O)CCN(CC(N)=O)CCN(CC(N)=O)CCN(CC(N)=O)CC1 |
| | DO3AM-acetic acid Usage And Synthesis |
| Uses | DOTAM-mono-acid, is a dendritic PARACEST contrast agents for magnetic resonance imaging, and are highly suitable for pH mapping. | | IC 50 | RDC Bifunctional Chelator |
| | DO3AM-acetic acid Preparation Products And Raw materials |
|