|
|
| | propyl-delta(8)-tetrahydrocannabinol Basic information |
| Product Name: | propyl-delta(8)-tetrahydrocannabinol | | Synonyms: | propyl-delta(8)-tetrahydrocannabinol;6H-Dibenzo[b,d]pyran-1-ol, 6a,7,10,10a-tetrahydro-6,6,9-trimethyl-3-propyl-, (6aR,10aR)-;Δ8-Tetrahydrocannabivarin;Δ8-Tetrahydrocannabivarin (exempt preparation);Delta8-Tetrahydrocannabivarin (Delta8-THCV) solution;Δ8-Tetrahydrocannabivarin (Alt. Batch CRM);Δ8-Tetrahydrocannabivarin (CRM) | | CAS: | 31262-38-1 | | MF: | C19H26O2 | | MW: | 286.41 | | EINECS: | | | Product Categories: | | | Mol File: | 31262-38-1.mol |  |
| | propyl-delta(8)-tetrahydrocannabinol Chemical Properties |
| Boiling point | 353.2±42.0 °C(Predicted) | | density | 1.034±0.06 g/cm3(Predicted) | | storage temp. | -65 to -96°C | | solubility | DMF: 50 mg/ml DMSO: 50 mg/ml DMSO: PBS (pH 7.2) (1:3): 250µg/ml Ethanol: 30 mg/ml Methanol: 30 mg/ml | | pka | 9.81±0.60(Predicted) | | InChI | 1S/C19H26O2/c1-5-6-13-10-16(20)18-14-9-12(2)7-8-15(14)19(3,4)21-17(18)11-13/h7,10-11,14-15,20H,5-6,8-9H2,1-4H3/t14-,15-/m1/s1 | | InChIKey | CDBDULHNWQRYSY-HUUCEWRRSA-N | | SMILES | O1C([C@H]2[C@@H](CC(=CC2)C)c3c1cc(cc3O)CCC)(C)C |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | propyl-delta(8)-tetrahydrocannabinol Usage And Synthesis |
| Description | Δ8-Tetrahydrocannabivarin is an analytical reference standard categorized as a cannabinoid.1 Δ8-Tetrahydrocannabivarin is regulated as a Schedule I compound in the United States. Δ8-Tetrahydrocannabivarin is provided as a DEA exempt preparation. This product is intended for research and forensic applications. | | Uses | Δ8-Tetrahydrocannabivarin is a cannabinoid[1]. | | References | [1] Bátkai, S., Mukhopadhyay, P., Horváth, B., et al. Δ8-Tetrahydrocannabivarin prevents hepatic ischaemia/reperfusion injury by decreasing oxidative stress and inflammatory responses through cannabinoid CB2 receptors Br. J. Pharmacol. 165(8),2450-2461(2012). |
| | propyl-delta(8)-tetrahydrocannabinol Preparation Products And Raw materials |
|