EVOLITRINE manufacturers
- Evolitrine
-
- $81.00
-
2026-07-15
- CAS:523-66-0
- Purity: 99.98%
- Supply Ability: 10g
|
| | EVOLITRINE Basic information |
| Product Name: | EVOLITRINE | | Synonyms: | EVOLITRINE;4,7-Dimethoxyfuro[2,3-b]quinoline;O-Methylconfusameline;Furo[2,3-b]quinoline, 4,7-dimethoxy-;inhibit,Evolitrine,7-Methoxydictamnine,Evolitrin,Inhibitor;Evolitrine, 10 mM in DMSO;Evolitle. | | CAS: | 523-66-0 | | MF: | C13H11NO3 | | MW: | 229.23 | | EINECS: | | | Product Categories: | | | Mol File: | 523-66-0.mol |  |
| | EVOLITRINE Chemical Properties |
| Melting point | 114-115 °C | | Boiling point | 381.0±37.0 °C(Predicted) | | density | 1.261±0.06 g/cm3(Predicted) | | pka | 7.87±0.40(Predicted) | | form | Solid | | color | Off-white to light yellow | | InChI | InChI=1S/C13H11NO3/c1-15-8-3-4-9-11(7-8)14-13-10(5-6-17-13)12(9)16-2/h3-7H,1-2H3 | | InChIKey | TWGHMXOYRUTQOL-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(OC)C=2)C(OC)=C2C=COC=12 |
| | EVOLITRINE Usage And Synthesis |
| Chemical Properties | Yellow needle crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Evodia rutaecarpa. | | Uses | Evolitrine (7-Methoxydictamnine; Evolitrin) is isolated from Acronychia pedunculata and show anti-inflammatory and antifeedant activities[1]. | | References | [1] lL.B.de Silva,et al. Kokusaginine and evolitrine from Acronychia pedunculata.Volume 18, Issue 7,1979, Pages 1255-1256
[2] Bansi Lal, et al. Isolation, synthesis and biological activity of Evolitrine and analogs. Issue in Honor of Prof. Nitya Anand |
| | EVOLITRINE Preparation Products And Raw materials |
|