|
|
| | 3-chloro-5-nitro-benzoic acid Basic information |
| Product Name: | 3-chloro-5-nitro-benzoic acid | | Synonyms: | 3-chloro-5-nitro-benzoic acid;3-Nitro-5-chlorobenzoic acid;3-Chloro-5-nitrobenzoic acid: 3-Nitro-5-chlorobenzoic acid;3-Chloro-5-nitrobenzoic acid 98%;Benzoic acid, 3-chloro-5-nitro- | | CAS: | 34662-36-7 | | MF: | C7H4ClNO4 | | MW: | 201.56 | | EINECS: | | | Product Categories: | | | Mol File: | 34662-36-7.mol |  |
| | 3-chloro-5-nitro-benzoic acid Chemical Properties |
| Boiling point | 351.1±27.0 °C(Predicted) | | density | 1.602±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.11±0.10(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C7H4ClNO4/c8-5-1-4(7(10)11)2-6(3-5)9(12)13/h1-3H,(H,10,11) | | InChIKey | YLQAJBKACBLUCM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=CC(Cl)=C1 |
| | 3-chloro-5-nitro-benzoic acid Usage And Synthesis |
| Uses | 3-Chloro-5-nitrobenzoic acid | | Synthesis | Concentrated sulfuric acid (12 mL) was slowly added to concentrated nitric acid (1.6 mL) under cooling conditions in an ice bath and the reaction mixture was kept stirring for 5 min at 0 °C. Subsequently, 3-chlorobenzoic acid (3 g) was added in batches over 5 min, and the temperature of the reaction system was gradually brought to room temperature with continuous stirring for 1 h. The reaction was carried out in an ice bath under cooling conditions. Upon completion of the reaction, the reaction solution was slowly added dropwise to ice-cooled water, and the precipitated solid product was collected by filtration and washed thoroughly with cold water to finally obtain a white solid 3-chloro-5-nitrobenzoic acid (Compound 0004-1, 2.65 g). | | References | [1] Bioorganic and Medicinal Chemistry Letters, 2013, vol. 23, # 16, p. 4557 - 4561
[2] Patent: JP6052673, 2016, B2. Location in patent: Paragraph 0081 |
| | 3-chloro-5-nitro-benzoic acid Preparation Products And Raw materials |
|