|
|
| | 1-Bromo-3-(1,1-difluoro-ethyl)-benzene
Basic information |
| | 1-Bromo-3-(1,1-difluoro-ethyl)-benzene
Chemical Properties |
| Boiling point | 195.7±30.0 °C(Predicted) | | density | 1.500 g/L at 25 °C | | refractive index | n20/D1.504 | | Fp | 87℃ | | storage temp. | 2-8°C | | form | liquid | | color | Clear, faint yellow | | InChI | InChI=1S/C8H7BrF2/c1-8(10,11)6-3-2-4-7(9)5-6/h2-5H,1H3 | | InChIKey | NCJAJYPBNUFMQK-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(C(F)(F)C)=C1 |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-61 | | RIDADR | UN3082 - class 9 - PG 3 - DOT NA1993 - Environmentally hazardous substances, liquid, n.o.s. HI: all (not BR) | | WGK Germany | 3 | | HS Code | 2903998090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-Bromo-3-(1,1-difluoro-ethyl)-benzene
Usage And Synthesis |
| | 1-Bromo-3-(1,1-difluoro-ethyl)-benzene
Preparation Products And Raw materials |
|