| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Bromo-3-(heptadecafluorodecyl)benzene Basic information |
| Product Name: | 1-Bromo-3-(heptadecafluorodecyl)benzene | | Synonyms: | 10-(3-Bromophenyl)-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane, 1-Bromo-3-(1H,1H,2H,2H-perfluorodecyl)benzene;1-Bromo-3-(1H,1H,2H,2H-perfluorodecyl)benzene;Benzene, 1-bromo-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-;1-Bromo-3-(heptadecafluorodecyl)benzene | | CAS: | 340157-97-3 | | MF: | C16H8BrF17 | | MW: | 603.11 | | EINECS: | | | Product Categories: | | | Mol File: | 340157-97-3.mol |  |
| | 1-Bromo-3-(heptadecafluorodecyl)benzene Chemical Properties |
| Melting point | 36-40 °C | | Boiling point | 307.9±42.0 °C(Predicted) | | density | 1.659±0.06 g/cm3(Predicted) | | form | powder | | BRN | 8880743 | | InChI | 1S/C16H8BrF17/c17-8-3-1-2-7(6-8)4-5-9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)16(32,33)34/h1-3,6H,4-5H2 | | InChIKey | AFJHWCKFHITISQ-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCc1cccc(Br)c1 | | EPA Substance Registry System | 1-Bromo-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)benzene (340157-97-3) |
| WGK Germany | 3 | | F | 10 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| | 1-Bromo-3-(heptadecafluorodecyl)benzene Usage And Synthesis |
| | 1-Bromo-3-(heptadecafluorodecyl)benzene Preparation Products And Raw materials |
|