|
|
| | 4-Chloro-2,3-dihydro-7-hydroxyinden-1-one Basic information |
| Product Name: | 4-Chloro-2,3-dihydro-7-hydroxyinden-1-one | | Synonyms: | 4-Chloro-2,3-dihydro-7-hydroxy-1H-inden-1-one;4-Chloro-7-hydroxyindan-1-one;4-Chloro-7-hydroxy-1-indanone;4-chloro-7-hydroxy-2,3-dihydro-1H-inden-1-one;1H-Inden-1-one, 4-chloro-2,3-dihydro-7-hydroxy-;4-Chloro-7-hydroxy-2,3-dihydroinden-1-one - [C72078];4-chloro-7-hydroxy-1-one;4-Chloro-2,3-dihydro-7-hydroxyinden-1-one | | CAS: | 81945-10-0 | | MF: | C9H7ClO2 | | MW: | 182.6 | | EINECS: | | | Product Categories: | | | Mol File: | 81945-10-0.mol |  |
| | 4-Chloro-2,3-dihydro-7-hydroxyinden-1-one Chemical Properties |
| Melting point | 122℃ | | Boiling point | 362℃ | | density | 1.456 | | Fp | 173℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | pka | 9.84±0.20(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C9H7ClO2/c10-6-2-4-8(12)9-5(6)1-3-7(9)11/h2,4,12H,1,3H2 | | InChIKey | YVNMNVRDMWVUNR-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C(Cl)=CC=C2O)CC1 |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-Chloro-2,3-dihydro-7-hydroxyinden-1-one Usage And Synthesis |
| | 4-Chloro-2,3-dihydro-7-hydroxyinden-1-one Preparation Products And Raw materials |
|