- 2,2'-BIPYRROL
-
- $8.00
-
2026-08-25
- CAS:10087-64-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- 2,2'-BIPYRROL
-
- $1.00
-
2020-03-06
- CAS:10087-64-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
- 2,2'-Bipyrrole
-
- $9.80
-
2020-02-07
- CAS:10087-64-6
- Min. Order: 1KG
- Purity: >98%HPLC
- Supply Ability: 20 tons
|
| | 2,2'-Bipyrrol Basic information |
| Product Name: | 2,2'-Bipyrrol | | Synonyms: | 2,2´Bipyrrole;-Bipyrrole;2,2'-Bispyrrole;NSC 90886;2-(1H-pyrrol-2-yl)-1H-pyrrole;Ketorolac Impurity 25;1H,1'H-2,2'-Bipyrrole | | CAS: | 10087-64-6 | | MF: | C8H8N2 | | MW: | 132.16 | | EINECS: | | | Product Categories: | Miscellaneous | | Mol File: | 10087-64-6.mol |  |
| | 2,2'-Bipyrrol Chemical Properties |
| Melting point | 189-190°C | | Boiling point | 372.1±17.0 °C(Predicted) | | density | 1.186±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly) | | form | Solid | | pka | 17.45±0.50(Predicted) | | color | Pale Grey to Light Beige | | Major Application | pharmaceutical | | InChI | InChI=1S/C8H8N2/c1-3-7(9-5-1)8-4-2-6-10-8/h1-6,9-10H | | InChIKey | ULUNQYODBKLBOE-UHFFFAOYSA-N | | SMILES | N1C=CC=C1C1=CC=CN1 |
| | 2,2'-Bipyrrol Usage And Synthesis |
| Chemical Properties | Light Grey to Pale Brown Solid | | Uses | 2,2'-Bipyrrole is used as a facilitator in the electrochemical polymerization of pyrrole and N-methylpyrrole. |
| | 2,2'-Bipyrrol Preparation Products And Raw materials |
|