|
|
| | Dihydro Ketoprofen (Mixture of Diastereomers) Basic information |
| | Dihydro Ketoprofen (Mixture of Diastereomers) Chemical Properties |
| Melting point | 118-120°C | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | InChI | InChI=1S/C16H16O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11,15,17H,1H3,(H,18,19) | | InChIKey | KBVIDAVUDXDUPS-UHFFFAOYSA-N | | SMILES | C1(C(C)C(O)=O)=CC=CC(C(O)C2=CC=CC=C2)=C1 | | CAS DataBase Reference | 59960-32-6 |
| | Dihydro Ketoprofen (Mixture of Diastereomers) Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | A metabolite of Ketoprofen. |
| | Dihydro Ketoprofen (Mixture of Diastereomers) Preparation Products And Raw materials |
|