4-Aminophenylboronic acid manufacturers
- 4-Aminophenylboronic acid
-
- $15.00 / 1KG
-
2021-08-12
- CAS:89415-43-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-Aminophenylboronic acid Basic information |
| | 4-Aminophenylboronic acid Chemical Properties |
| Melting point | 62-66 | | Boiling point | 355.0±44.0 °C(Predicted) | | density | 1.23 | | storage temp. | Store Cold | | pka | 8.82±0.10(Predicted) | | form | solid | | color | Off white | | InChI | InChI=1S/C6H8BNO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4,9-10H,8H2 | | InChIKey | MKPDAJWEBQRQCO-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(N)C=C1)(O)O | | CAS DataBase Reference | 89415-43-0(CAS DataBase Reference) |
| | 4-Aminophenylboronic acid Usage And Synthesis |
| Chemical Properties | Crystalline powder | | Uses | 4-Aminophenylboronic Acid is a compound being used in the discovery of multi-target receptor tyrosine kinase inhibitors as novel anti-angiogenesis agents. |
| | 4-Aminophenylboronic acid Preparation Products And Raw materials |
|