1-Boc-hexahydro-1H-azepin-4-amine manufacturers
|
| | 1-Boc-hexahydro-1H-azepin-4-amine Basic information |
| Product Name: | 1-Boc-hexahydro-1H-azepin-4-amine | | Synonyms: | 4-AMINO-AZEPANE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;1H-AZEPINE-1-CARBOXYLIC ACID, 4-AMINOHEXAHYDRO-, 1,1-DIMETHYLETHYL ESTER;1-N-BOC-HEXAHYDRO-1H-AZEPIN-4-AMINE;1-Boc-hexahydro-1H-azepin-4-amine;4-Amino-1-Boc-hexahydro-1H-azepine;tert-butyl 4-aminoazepane-1-carboxylate hydrochloride;1-N-t-butoxycarbonyl-hexahydro-1H-azepin-4-amine;4-Amino-1-Boc-azepane | | CAS: | 196613-57-7 | | MF: | C11H22N2O2 | | MW: | 214.31 | | EINECS: | 200-110-4 | | Product Categories: | pharmacetical | | Mol File: | 196613-57-7.mol |  |
| | 1-Boc-hexahydro-1H-azepin-4-amine Chemical Properties |
| Boiling point | 296 ºC | | density | 1.020 | | Fp | 133 ºC | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | liquid | | pka | 10.41±0.20(Predicted) | | color | Light yellow to yellow | | InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-7-4-5-9(12)6-8-13/h9H,4-8,12H2,1-3H3 | | InChIKey | YCOKHOLOSGJEGL-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCCC(N)CC1 | | CAS DataBase Reference | 196613-57-7 |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 1-Boc-hexahydro-1H-azepin-4-amine Usage And Synthesis |
| Uses | tert-butyl 4-aminoazepane-1-carboxylate is a useful reagent in the preparation of piperidinyl-nicotinamides used as selective somatostatin receptor subtype 5 antagonists (SSTR5 antagonists). |
| | 1-Boc-hexahydro-1H-azepin-4-amine Preparation Products And Raw materials |
|