|
|
| Product Name: | 4,4'-Bis(2,2-diphenylvinyl)-1,1'-biphenyl | | Synonyms: | DPVBI;4,4'-BIS(2,2-DIPHENYLETHEN-1-YL)BIPHENYL;4,4'-Bis(2,2-diphenylvinyl)-1,1'-biphenyl;4,4-BIS(2,2-DIPHENYL-ETHEN-1-YL)-DIPHENYL BLUE EMITTER 450;4,4'-Bis(2,2-diphenylvinyl)biphenyl-1,1'-biphenyl;1,4-bis(2,2-diphenylvinyl)biphenyl;4,4'-Bis(2,2-dipheny;4,4'-Bis(2,2-diphenylvinyl)biphenyl | | CAS: | 142289-08-5 | | MF: | C40H30 | | MW: | 510.67 | | EINECS: | | | Product Categories: | oled materials;electronic;Electronic Chemicals;OLED | | Mol File: | 142289-08-5.mol |  |
| | 4,4'-Bis(2,2-diphenylvinyl)-1,1'-biphenyl Chemical Properties |
| Melting point | 207°C | | Boiling point | 627.3±55.0 °C(Predicted) | | density | 1.124±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | λmax | 353nm(CHCl3)(lit.) | | InChI | InChI=1S/C40H30/c1-5-13-35(14-6-1)39(36-15-7-2-8-16-36)29-31-21-25-33(26-22-31)34-27-23-32(24-28-34)30-40(37-17-9-3-10-18-37)38-19-11-4-12-20-38/h1-30H | | InChIKey | UHXOHPVVEHBKKT-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(/C=C(/C3=CC=CC=C3)\C3=CC=CC=C3)C=C2)=CC=C(/C=C(/C2=CC=CC=C2)\C2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 142289-08-5 | | Absorption | λmax351 nm (THF) |
| | 4,4'-Bis(2,2-diphenylvinyl)-1,1'-biphenyl Usage And Synthesis |
| Classification | Hole-injection materials, Hole-transporting materials, Blue light-emitting materials, Host materials, Organic light-emitting diodes (OLEDs), Organic electronics. | | Applications | DPVBi, 4,4 -bis(2,2 -diphenylvinyl)-1,1 -diphenyl, is a wide band gap small molecule semiconducting material, commonly used as a blue host-emitting material in OLEDs.
It has been reported that DPVBi can effectively manipulate the Schottky energy barrier between the ITO and the emitting layer, and thus significantly enhance hole-injection, current and luminance efficiencies of OLEDs, as well as their stability.
| | Description | DPVBi, 4,4 -bis(2,2 -diphenylvinyl)-1,1 -diphenyl, is a wide band gap small molecule semiconducting material, commonlyusedas a blue host-emitting material in OLEDs. | | Chemical Properties | Light yellow powder |
| | 4,4'-Bis(2,2-diphenylvinyl)-1,1'-biphenyl Preparation Products And Raw materials |
|