| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Tocopharm Co., Ltd. |
| Tel: |
+86-021-69895597 13776836200 +86-13776836200 |
| Email: |
tocopharm@gmail.com |
|
| | 3,5-Dinitrobenzyl chloride Basic information |
| Product Name: | 3,5-Dinitrobenzyl chloride | | Synonyms: | ALPHA-CHLORO-3,5-DINITROTOLUENE;1-(chloromethyl)-3,5-dinitro-benzen;α-chloro-3,5-dinitrotoluene;Benzene, 1-(chloromethyl)-3,5-dinitro-;Ccris 3134;Einecs 277-841-7;Toluene, alpha-chloro-3,5-dinitro-;3,5-Dinitrobenzyl chloride purum, >=97.0% (AT) | | CAS: | 74367-78-5 | | MF: | C7H5ClN2O4 | | MW: | 216.58 | | EINECS: | 277-841-7 | | Product Categories: | Chemical Synthesis;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;Building Blocks | | Mol File: | 74367-78-5.mol |  |
| | 3,5-Dinitrobenzyl chloride Chemical Properties |
| Melting point | 79-82 °C (lit.) | | Boiling point | 373.4±27.0 °C(Predicted) | | density | 1.538±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | Light yellow to yellow Solid | | BRN | 2506587 | | InChI | 1S/C7H5ClN2O4/c8-4-5-1-6(9(11)12)3-7(2-5)10(13)14/h1-3H,4H2 | | InChIKey | SMJODKZAFKWUJG-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(CCl)cc(c1)[N+]([O-])=O | | CAS DataBase Reference | 74367-78-5 | | EPA Substance Registry System | Benzene, 1-(chloromethyl)-3,5-dinitro- (74367-78-5) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | CZ0770000 | | F | 10-19-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
STOT SE 3 |
| | 3,5-Dinitrobenzyl chloride Usage And Synthesis |
| Uses | 3,5-Dinitrobenzyl chloride was used in the synthesis of double-spanned double cavity calix[4]arenes and 3,5-dinitrobenzylamines. It also was used in fluorescence flow immunoassay for determination of 4-nitrophenol. |
| | 3,5-Dinitrobenzyl chloride Preparation Products And Raw materials |
|