|
|
| | 2,4-Dinitrobenzyl chloride Basic information |
| Product Name: | 2,4-Dinitrobenzyl chloride | | Synonyms: | 2-Chloro-2，4-dinitrotoluene;ALPHA-CHLORO-2,4-DINITROTOLUENE;LABOTEST-BB LT00159954;2,4-Dinitrobenzyl chloride 99%;o,p-Dinitrobenzyl chloride;2,4-Dinitrobenzyl chloride, 98+%;Benzene, 1-(chloromethyl)-2,4-dinitro-;à-chloro-2,4-dinitrotoluene | | CAS: | 610-57-1 | | MF: | C7H5ClN2O4 | | MW: | 216.58 | | EINECS: | 210-230-5 | | Product Categories: | | | Mol File: | 610-57-1.mol |  |
| | 2,4-Dinitrobenzyl chloride Chemical Properties |
| Melting point | 34-36 °C(lit.) | | Boiling point | 349.8±27.0 °C(Predicted) | | density | 1.538±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | InChI | 1S/C7H5ClN2O4/c8-4-5-1-2-6(9(11)12)3-7(5)10(13)14/h1-3H,4H2 | | InChIKey | DARDYTBLZQDXBK-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(CCl)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 610-57-1(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8B - Non-combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,4-Dinitrobenzyl chloride Usage And Synthesis |
| Uses | 2,4-Dinitrobenzyl chloride was used in the synthesis of 2-(2,4-dinitrobenzylthio) and 2-(2,4-dinitrobenzylseleno) derivatives of 4,5-dihydroimidazolium chloride. |
| | 2,4-Dinitrobenzyl chloride Preparation Products And Raw materials |
|