|
|
| | Dihydromorphine Basic information |
| | Dihydromorphine Chemical Properties |
| Melting point | 157 °C (decomp) | | Boiling point | 475.4±45.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | Fp | 9°C | | storage temp. | -20°C | | pka | pKa 8.55(50% aq EtOH) (Uncertain) | | form | liquid | | Major Application | forensics and toxicology | | InChI | 1S/C17H21NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2,4,10-11,13,16,19-20H,3,5-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 | | InChIKey | IJVCSMSMFSCRME-KBQPJGBKSA-N | | SMILES | O[C@@H](CC1)[C@@]2([H])[C@@]3([C@]1([H])[C@H](N(C)CC3)C4)C5=C4C=CC(O)=C5O2 | | CAS DataBase Reference | 509-60-4 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | Dihydromorphine Usage And Synthesis |
| Uses | Dihydromorphine is a metabolite of Hydromorphone (H714650). | | Definition | ChEBI: Dihydromorphine is a morphinane alkaloid. |
| | Dihydromorphine Preparation Products And Raw materials |
|