| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4,6-Bis(diphenylphosphino)phenoxazine Basic information | | Reactions |
| Product Name: | 4,6-Bis(diphenylphosphino)phenoxazine | | Synonyms: | 4,6-Bis(diphenylphosphino)phenoxazine 97%;N-XantPhos 97%;4,6-Bis(diphenylphosphino)phenoxazine, min. 98%;4,6-BIS(DIPHENYLPHOSPHINO)-10H-PHENOXAZINE;4,6-Bis(diphenylphosphino)phenoxazine, NIXANTPHOS;4,6-Bis(diphenylphosphino)phenoxazine,min.98%NIXANTPHOS;4,6-Bis(diphenylphosphino)phenoxazine, 98+%;(6-diphenylphosphanyl-10H-phenoxazin-4-yl)-diphenylphosphane | | CAS: | 261733-18-0 | | MF: | C36H27NOP2 | | MW: | 551.55 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Phosphine Ligands;Synthetic Organic Chemistry;organophosphine ligand | | Mol File: | 261733-18-0.mol |  |
| | 4,6-Bis(diphenylphosphino)phenoxazine Chemical Properties |
| Melting point | 256-262 °C | | Boiling point | 662.1±55.0 °C(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 1.34±0.20(Predicted) | | form | Powder | | color | white to off-white | | Water Solubility | Miscible with water. | | InChI | 1S/C36H27NOP2/c1-5-15-27(16-6-1)39(28-17-7-2-8-18-28)33-25-13-23-31-35(33)38-36-32(37-31)24-14-26-34(36)40(29-19-9-3-10-20-29)30-21-11-4-12-22-30/h1-26,37H | | InChIKey | HSWZLYXRAOXOLL-UHFFFAOYSA-N | | SMILES | C1=C2C(OC3=C(N2)C=CC=C3P(C2=CC=CC=C2)C2=CC=CC=C2)=C(P(C2=CC=CC=C2)C2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 261733-18-0 |
| Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2934.99.4400 | | Storage Class | 11 - Combustible Solids |
| | 4,6-Bis(diphenylphosphino)phenoxazine Usage And Synthesis |
| Reactions |
- A large bite-angle chelating bisphosphine that provides high levels of linear-to-branched selectivity in the hydroformylation of alkenes.
- A Deprotonatable Ligand for Room-Temperature Palladium-Catalyzed Cross-Couplings of Aryl Chlorides.
| | Uses | 4,6-Bis(Diphenylphosphino)phenoxazine is used as a palladium catalyst in reactions involving the synthesis of triarylmethanes. | | Uses | 4,6-Bis(diphenylphosphino)phenoxazine used as an intermediate in the manufacture of pharmaceuticals, agrochemicals, dyestuffs, fine chemicals, medical and material synthesis. | | Uses | N-XantPhos is a deprotonatable chelating aryldiphosphine ligand that can be used in:
- The preparation of Pd-NiXantphos catalyst system for the room temperature cross-coupling reactions of unactivated aryl chlorides.
- The synthesis of cinchonine iridium(III) cyclometalated complex that exhibits luminescence and good quantum efficiency.
- N-XantPhos and N-modified counterparts are also used in the preparation of rhodium based catalysts for hydroformylation reaction.
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand
reaction type: Cross Couplings |
| | 4,6-Bis(diphenylphosphino)phenoxazine Preparation Products And Raw materials |
|