|
|
| | 2-Bromopropane-1,1,1,3,3,3-d6 Basic information |
| Product Name: | 2-Bromopropane-1,1,1,3,3,3-d6 | | Synonyms: | 2-BroMopropane--d6;2-Bromo-1,1,1,3,3,3-hexadeuteriopropane;2-Bromopropane-1,1,1,3,3,3-d6;2-Bromopropane-1,1,1,3,3,3-d6 | | CAS: | 52809-76-4 | | MF: | C3HBrD6 | | MW: | 129.03 | | EINECS: | | | Product Categories: | Aliphatics, Isotope Labelled Compounds, Miscellaneous Reagents | | Mol File: | 52809-76-4.mol |  |
| | 2-Bromopropane-1,1,1,3,3,3-d6 Chemical Properties |
| Boiling point | 48-50 °C | | density | 1.342±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | solubility | soluble in Chloroform, Methanol | | form | Oil | | color | Clear Colourless | | InChI | 1S/C3H7Br/c1-3(2)4/h3H,1-2H3/i1D3,2D3 | | InChIKey | NAMYKGVDVNBCFQ-WFGJKAKNSA-N | | SMILES | [2H]C([2H])([2H])C(Br)C([2H])([2H])[2H] |
| Hazard Codes | F,T | | Risk Statements | 60-11-48/20-66 | | Safety Statements | 53-45 | | WGK Germany | WGK 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 Repr. 1A STOT RE 2 Inhalation |
| | 2-Bromopropane-1,1,1,3,3,3-d6 Usage And Synthesis |
| Uses | 2-BROMOPROPANE-1,1,1,3,3,3-D6 is labelled analogue of 2-Bromopropane, a short chain alkyl halide used in organic synthesis primarily as an alkylating agent for introducing the isopropyl functional groups. |
| | 2-Bromopropane-1,1,1,3,3,3-d6 Preparation Products And Raw materials |
|