| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-Bromo-2-methylpropane-d9 Basic information |
| Product Name: | 2-Bromo-2-methylpropane-d9 | | Synonyms: | TERT-BUTYL BROMIDE-D9;2-Bromo-2-methylpropane-d9 98 atom % D;2-Bromo-2-methylpropane-d?;2-Bromo-2-methylpropane-d9;2-bromo-2-(methyl-d3)propane-1,1,1,3,3,3-d6;2-Bromo-2-methylpropane-d9 | | CAS: | 42310-83-8 | | MF: | C4BrD9 | | MW: | 146.07 | | EINECS: | | | Product Categories: | | | Mol File: | 42310-83-8.mol |  |
| | 2-Bromo-2-methylpropane-d9 Chemical Properties |
| Melting point | -20 °C(lit.) | | Boiling point | 72-74 °C(lit.) | | density | 1.295 g/mL at 25 °C | | Fp | 16 °C | | storage temp. | 0-6°C | | InChI | InChI=1S/C4H9Br/c1-4(2,3)5/h1-3H3/i1D3,2D3,3D3 | | InChIKey | RKSOPLXZQNSWAS-GQALSZNTSA-N | | SMILES | C(Br)(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16-33 | | RIDADR | UN 2342 3/PG 2 | | WGK Germany | 3 | | RTECS | TX4150000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | 2-Bromo-2-methylpropane-d9 Usage And Synthesis |
| Uses | 2-Bromo-2-methylpropane-d9 (CAS# 42310-83-8) is a useful isotopically labeled research compound. |
| | 2-Bromo-2-methylpropane-d9 Preparation Products And Raw materials |
|