|
|
| | 3H-1,2-BENZODITHIOL-3-ONE Basic information |
| | 3H-1,2-BENZODITHIOL-3-ONE Chemical Properties |
| Melting point | 74-77 °C(lit.) | | Boiling point | 337.6±25.0 °C(Predicted) | | density | 1.476±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | toluene: soluble2.5%, clear, yellow | | form | solid | | Appearance | Yellow to orange Solid | | BRN | 119513 | | InChI | InChI=1S/C7H4OS2/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4H | | InChIKey | GZTYTTPPCAXUHB-UHFFFAOYSA-N | | SMILES | C1(SSC2C=CC=CC1=2)=O |
| Safety Statements | 22-24/25 | | RIDADR | UN 3335 | | WGK Germany | 3 | | F | 9-13-23 | | Storage Class | 11 - Combustible Solids |
| | 3H-1,2-BENZODITHIOL-3-ONE Usage And Synthesis |
| Uses | 3H-1,2-Benzodithiol-3-one (1,2-benzodithiol-3-one) may be used as sulfur-transferring agent for the transformation of H-phosphonothioate and H-phosphonate diesters into the corresponding phosphorodi- and phosphoromonothioates. | | General Description | 3H-1,2-Benzodithiol-3-one is a heterocyclic building block. |
| | 3H-1,2-BENZODITHIOL-3-ONE Preparation Products And Raw materials |
|