|
|
| | 3-(4-acetylphenyl)-2-aminopropanoic acid hydrochloride Basic information |
| Product Name: | 3-(4-acetylphenyl)-2-aminopropanoic acid hydrochloride | | Synonyms: | 3-(4-acetylphenyl)-2-aminopropanoic acid hydrochloride;(S)-3-(4-acetylphenyl)-2-aMinopropanoic acid hydrochloride;Alanine, 3-(p-acetylphenyl)-, hydrochloride, L- (8CI);3-(4-ACETYLPHENYL)-2-AMINOPROPANOIC ACID HCL;H-Phe(4-Ac)-OH.HCl;(2S)-3-(4-acetylphenyl)-2-aminopropanoic acid;4-ACETYLPHENYLALANINE HYDROCHLORIDE (1:1) | | CAS: | 20299-31-4 | | MF: | C11H14ClNO3 | | MW: | 243.69 | | EINECS: | | | Product Categories: | | | Mol File: | 20299-31-4.mol |  |
| | 3-(4-acetylphenyl)-2-aminopropanoic acid hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | Pale Yellow to Brown | | InChI | InChI=1/C11H13NO3.ClH/c1-7(13)9-4-2-8(3-5-9)6-10(12)11(14)15;/h2-5,10H,6,12H2,1H3,(H,14,15);1H/t10-;/s3 | | InChIKey | TZRAOLAVYBTWGD-MEQOOBBNNA-N | | SMILES | C(C1C=CC(C(=O)C)=CC=1)[C@H](N)C(=O)O.Cl |&1:10,r| |
| | 3-(4-acetylphenyl)-2-aminopropanoic acid hydrochloride Usage And Synthesis |
| Uses | 4-Acetyl-L-phenylalanine Hydrochloride is the 4-acetyl analogue of the essential amino acid L-phenylaniline. 4-Acetyl-L-phenylalanine as well as other unnatural amino acids can be genetically incorporated successfully into proteins in Escherichia coli as well as mammalian cells. |
| | 3-(4-acetylphenyl)-2-aminopropanoic acid hydrochloride Preparation Products And Raw materials |
|