| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | L-2-Bromophenylalanine Basic information |
| | L-2-Bromophenylalanine Chemical Properties |
| Melting point | 270°C (dec.) | | Boiling point | 363.2±32.0 °C(Predicted) | | density | 1.588±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | 2.16±0.10(Predicted) | | color | Off-white | | InChI | InChI=1S/C9H10BrNO2/c10-7-4-2-1-3-6(7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 | | InChIKey | JFVLNTLXEZDFHW-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1Br)N | | CAS DataBase Reference | 42538-40-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | HS Code | 2922498590 |
| | L-2-Bromophenylalanine Usage And Synthesis |
| References | [1] Tetrahedron Letters, 2016, vol. 57, # 41, p. 4612 - 4615 |
| | L-2-Bromophenylalanine Preparation Products And Raw materials |
|