|
|
| | 2-METHOXYBENZENESULFONYL CHLORIDE Basic information |
| Product Name: | 2-METHOXYBENZENESULFONYL CHLORIDE | | Synonyms: | AKOS BB-9465;2-METHOXYBENZENESULFONYL CHLORIDE;5-Methoxybenzenesulfonyl chloride;2-Methoxybenzene-1-sulfonyl chloride;2-(Methyloxy)benzenesulfonyl chloride;2-Methoxyphenylsulfonyl chloride;o-Methoxybenzenesulfonyl chloride;M**2-METHOXYBENZENE SULFONYL CHLORIDE | | CAS: | 10130-87-7 | | MF: | C7H7ClO3S | | MW: | 206.65 | | EINECS: | | | Product Categories: | | | Mol File: | 10130-87-7.mol |  |
| | 2-METHOXYBENZENESULFONYL CHLORIDE Chemical Properties |
| Melting point | 50-54°C | | Boiling point | 126-129 °C(Press: 0.3 Torr) | | density | 1.376 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Light brown to brown Solid | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C7H7ClO3S/c1-11-6-4-2-3-5-7(6)12(8,9)10/h2-5H,1H3 | | InChIKey | GYOBZOBUOMDRRN-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1OC | | CAS DataBase Reference | 10130-87-7 |
| Hazard Codes | Xi | | Risk Statements | 34-43 | | Safety Statements | 26-36/37/39-36/37 | | RIDADR | 3261 | | HazardClass | IRRITANT | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 2930909899 |
| | 2-METHOXYBENZENESULFONYL CHLORIDE Usage And Synthesis |
| Uses | For synthesis and pharmacological evaluation of sulfonamide derivatives of thiazolidin-4-ones 5-Bromo-2-methoxybenzenesulfonyl chloride is used. | | Synthesis | General procedure for the synthesis of 2-methoxybenzenesulfonyl chloride from 2-methoxybenzenethiol: To a solution of 2-methoxybenzenethiol (1 eq.) and isopropanol (CAS: 67-63-0) (2 eq.) in methylene chloride (0.15 M) was added batchwise N-bromosuccinimide (CAS: 128-08-5) or N-chlorosuccinimide (CAS: 128-09- 6) (4 or 3.5 equivalents), and the reaction was carried out at room temperature (when using NBS) or at 0 °C (when using NCS). The reaction mixture was stirred at room temperature until the starting material was undetectable by thin layer chromatography (TLC) (about 1 hour). Subsequently, the reaction mixture was diluted with cold saturated NaHCO3 solution and extracted with ethyl acetate (4 times). The organic extracts were combined, dried with Na2SO4 and concentrated in vacuum to give the crude product. Finally, pure 2-methoxybenzenesulfonyl chloride was purified by silica gel column chromatography or radial chromatography using a hexane/ethyl acetate/acetone solvent mixture as eluent to obtain pure 2-methoxybenzenesulfonyl chloride. | | References | [1] Tetrahedron Letters, 2017, vol. 58, # 23, p. 2244 - 2247
[2] Green Chemistry, 2017, vol. 19, # 9, p. 2286 - 2295 |
| | 2-METHOXYBENZENESULFONYL CHLORIDE Preparation Products And Raw materials |
|