| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Kelex-100 manufacturers
- Kelex-100
-
- $10.00
-
2026-09-18
- CAS:73545-11-6
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 1 ton
- Kelex-100
-
- $8.00
-
2026-09-02
- CAS:73545-11-6
- Min. Order: 1KG
- Purity: 99%
- Kelex-100
-
- $8.00
-
2026-09-02
- CAS:73545-11-6
- Min. Order: 1KG
- Purity: 99%
|
| | Kelex-100 Basic information |
| Product Name: | Kelex-100 | | Synonyms: | 7-(4-ethyl-1-methyloctyl)-8-quinolino;7-(4-Ethyl-1-methyloctyl)-8-quinolinol;KELEX-100,7-(4-ETHYL-1-METHYLOCTYL)-8-HYDROXYQUINOLINE;7-(1-Methyl-4-ethyloctyl)quinoline-8-ol;7-(4-Ethyl-1-methyloctyl)quinoline-8-ol;8-Quinolinol, 7-(4-ethyl-1-methyloctyl)-;7-(4-ETHYL-1-METHYLOCTYL)-8-HYDROXYQUINOLINE 85%;NODS-78 (Kelex-100) | | CAS: | 73545-11-6 | | MF: | C20H29NO | | MW: | 299.45 | | EINECS: | 277-531-1 | | Product Categories: | Quinolines | | Mol File: | 73545-11-6.mol |  |
| | Kelex-100 Chemical Properties |
| Boiling point | 250°C | | density | 1.005±0.06 g/cm3(Predicted) | | vapor pressure | 0.002Pa at 20℃ | | storage temp. | 2-8°C | | pka | 4.94±0.50(Predicted) | | form | viscous liquid | | color | Very dark red/brown | | InChI | InChI=1S/C20H29NO/c1-4-6-8-16(5-2)11-10-15(3)18-13-12-17-9-7-14-21-19(17)20(18)22/h7,9,12-16,22H,4-6,8,10-11H2,1-3H3 | | InChIKey | YWACCMLWVBYNHR-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(C(C)CCC(CC)CCCC)C=2O)C=CC=1 | | LogP | 6.974 at 20℃ | | CAS DataBase Reference | 73545-11-6(CAS DataBase Reference) | | EPA Substance Registry System | 8-Quinolinol, 7-(4-ethyl-1-methyloctyl)- (73545-11-6) |
| TSCA | TSCA listed | | HS Code | 2933499090 |
| | Kelex-100 Usage And Synthesis |
| Chemical Properties | Pale yellow oily liquid | | Uses | Kelex-100 is a highly efficient metal ion extractant. |
| | Kelex-100 Preparation Products And Raw materials |
|