- cis-3-Hexenyl lactate
-
-
2026-08-07
- CAS:61931-81-5
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 5000kg/month
|
| | cis-3-Hexenyl lactate Basic information |
| | cis-3-Hexenyl lactate Chemical Properties |
| Boiling point | 71 °C0.7 mm Hg(lit.) | | density | 0.982 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.446(lit.) | | FEMA | 3690 | CIS-3-HEXENYL LACTATE | | Fp | >230 °F | | storage temp. | Store at room temperature, keep dry and cool | | pka | 13.03±0.20(Predicted) | | Specific Gravity | 0.984 | | Odor | at 100.00 %. green leafy sweet melon waxy violet leaf tropical fruity | | Appearance | Colorless to light yellow Liquid | | biological source | Mentha spicata L. | | Odor Type | green | | JECFA Number | 934 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C9H16O3/c1-3-4-5-6-7-12-9(11)8(2)10/h4-5,8,10H,3,6-7H2,1-2H3/b5-4- | | InChIKey | NNLLMULULOBXBY-PLNGDYQASA-N | | SMILES | [H]\C(CC)=C(/[H])CCOC(=O)C(C)O | | LogP | 1.52 | | CAS DataBase Reference | 61931-81-5(CAS DataBase Reference) | | NIST Chemistry Reference | Cis-3-hexenyllactate(61931-81-5) | | EPA Substance Registry System | Propanoic acid, 2-hydroxy-, (3Z)-3-hexenyl ester (61931-81-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29181100 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | cis-3-Hexenyl lactate Usage And Synthesis |
| Description | cis-3-Hexenyl lactate has a fruity-green odor. | | Chemical Properties | cis-3-Hexenyl lactate has a fruity-green odor | | Occurrence | Reported found in brandy and grape | | Definition | ChEBI: Cis-3-Hexenyl lactate is a carboxylic ester. | | Taste threshold values | Taste characteristics at 50 ppm: green, leafy, waxy with fruity, tropical nuances. |
| | cis-3-Hexenyl lactate Preparation Products And Raw materials |
|