|
|
| | 3-FORMYL-4-HYDROXYBENZOIC ACID Basic information |
| | 3-FORMYL-4-HYDROXYBENZOIC ACID Chemical Properties |
| Melting point | 246-250 °C (lit.) | | Boiling point | 254.32°C (rough estimate) | | density | 1.3579 (rough estimate) | | refractive index | 1.5090 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 4.22±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C8H6O4/c9-4-6-3-5(8(11)12)1-2-7(6)10/h1-4,10H,(H,11,12) | | InChIKey | NXZBZWZORYEIJL-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(O)C(C=O)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/38 | | Safety Statements | 26-36/37 | | WGK Germany | 2 | | HS Code | 2918999090 |
| | 3-FORMYL-4-HYDROXYBENZOIC ACID Usage And Synthesis |
| Synthesis | GENERAL METHOD: To a solution of trifluoroacetic acid (5 mL) of the substrate (1a-1q, 0.15 mmol) was sequentially added hexamethylenetetramine (urotropine, 0.3 mmol) and cuprous oxide (0.15 mmol). The reaction mixture was heated to reflux for 5 h and subsequently cooled to room temperature. A 3 N hydrochloric acid solution (5 mL) was slowly added to the reaction system and stirring was continued for 1 hour. Upon completion of the reaction, the mixture was concentrated under reduced pressure to remove the solvent. The crude product was purified by silica gel column chromatography (200-300 mesh) to afford the target product 3-formyl-4-hydroxybenzoic acid. | | References | [1] Bioconjugate Chemistry, 2018, vol. 29, # 9, p. 2909 - 2919
[2] Dalton Transactions, 2010, vol. 39, # 8, p. 2070 - 2077
[3] European Journal of Inorganic Chemistry, 2012, # 32, p. 5225 - 5238
[4] Research on Chemical Intermediates, 2015, vol. 41, # 11, p. 8147 - 8158
[5] Chemical Communications, 2018, vol. 54, # 42, p. 5385 - 5388 |
| | 3-FORMYL-4-HYDROXYBENZOIC ACID Preparation Products And Raw materials |
|