3-METHYLCARBAZOLE manufacturers
- 3-METHYLCARBAZOLE
-
-
2025-04-04
- CAS:4630-20-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | 3-METHYLCARBAZOLE Basic information |
| Product Name: | 3-METHYLCARBAZOLE | | Synonyms: | 3-METHYLCARBAZOLE;6-Methylcarbazole;NSC 10154;3-Methyl-9H-carbazole;9H-Carbazole, 3-methyl-;Carbazole, 3-methyl-;3-Methyl-9H-carbazole >;3-Methylcarbazole in toluene | | CAS: | 4630-20-0 | | MF: | C13H11N | | MW: | 181.23 | | EINECS: | 225-048-1 | | Product Categories: | | | Mol File: | 4630-20-0.mol |  |
| | 3-METHYLCARBAZOLE Chemical Properties |
| Melting point | 265℃ | | Boiling point | 365°C(lit.) | | density | 1.0941 (rough estimate) | | refractive index | 1.6191 (estimate) | | storage temp. | 4°C, protect from light | | form | powder to crystal | | color | White to Light yellow | | λmax | 342nm(EtOH)(lit.) | | InChI | InChI=1S/C13H11N/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h2-8,14H,1H3 | | InChIKey | PHKYYUQQYARDIU-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2=C1C=CC(C)=C2 | | CAS DataBase Reference | 4630-20-0 |
| | 3-METHYLCARBAZOLE Usage And Synthesis |
| Uses | 3-Methylcarbazole is an carbazole alkaloid compound with anticancer effects. 3-Methylcarbazole shows growth inhibitory activity (IC50 of 25 μg/mL) on human fibrosarcoma HT-1080 cells[1]. | | References | [1] Cheng-Bin Cui, et al. Carbazole alkaloids as new cell cycle inhibitor and apoptosis inducers from Clausena dunniana Levl. J Asian Nat Prod Res. 2002 Dec;4(4):233-41. DOI:10.1080/1028602021000049041 |
| | 3-METHYLCARBAZOLE Preparation Products And Raw materials |
|