|
|
| | 3,4-Dibromo-5-methylpyrazole Basic information |
| Product Name: | 3,4-Dibromo-5-methylpyrazole | | Synonyms: | MFCD00159652;4,5-DIBROMO-3-METHYL-1H-PYRAZOLE;1H-Pyrazole, 3,4-dibromo-5-methyl-;3,4-Dibromo-5-methylpyrazole;3-Methyl-4,5-dibrom-pyrazol;3,4-DibroMo-5-Methyl-1H-pyrazole | | CAS: | 5932-19-4 | | MF: | C4H4Br2N2 | | MW: | 239.9 | | EINECS: | | | Product Categories: | | | Mol File: | 5932-19-4.mol |  |
| | 3,4-Dibromo-5-methylpyrazole Chemical Properties |
| Melting point | 142 °C | | Boiling point | 329.3±37.0 °C(Predicted) | | density | 2.188±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 10.15±0.50(Predicted) | | InChI | InChI=1S/C4H4Br2N2/c1-2-3(5)4(6)8-7-2/h1H3,(H,7,8) | | InChIKey | HKWXBKMXJLNKLC-UHFFFAOYSA-N | | SMILES | N1C(C)=C(Br)C(Br)=N1 |
| | 3,4-Dibromo-5-methylpyrazole Usage And Synthesis |
| Uses | 3,4-Dibromo-5-methylpyrazole is a pharmaceutical intermediate that can be used as a constituent in the preparation of insecticides (tetrazolinone compounds). |
| | 3,4-Dibromo-5-methylpyrazole Preparation Products And Raw materials |
|