|
|
| | 3,6-Difluoro-2-methoxyphenylboronic acid Basic information |
| Product Name: | 3,6-Difluoro-2-methoxyphenylboronic acid | | Synonyms: | (3,6-Difluoro-2-methoxyphenyl);3,6-Difluoro-2-methoxybenzene boronic acid;Boronic acid, B-(3,6-difluoro-2-methoxyphenyl)-;(3,6-Difluoro-2-methoxyphenyl)boronic acid - [D89282];3,6-Difluoro-2-methoxyphenylboronic acid | | CAS: | 919355-30-9 | | MF: | C7H7BF2O3 | | MW: | 187.94 | | EINECS: | | | Product Categories: | | | Mol File: | 919355-30-9.mol |  |
| | 3,6-Difluoro-2-methoxyphenylboronic acid Chemical Properties |
| Melting point | 99-101 °C(Solv: water (7732-18-5); hexane (110-54-3)) | | Boiling point | 313.3±52.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | crystalline solid | | pka | 7.32±0.58(Predicted) | | color | White | | InChI | InChI=1S/C7H7BF2O3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-3,11-12H,1H3 | | InChIKey | AXJIPGDXAIMBDX-UHFFFAOYSA-N | | SMILES | B(C1=C(F)C=CC(F)=C1OC)(O)O |
| | 3,6-Difluoro-2-methoxyphenylboronic acid Usage And Synthesis |
| | 3,6-Difluoro-2-methoxyphenylboronic acid Preparation Products And Raw materials |
|