| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Fluoro-6-methoxyphenylboronic acid Basic information | | Preparation |
| | 2-Fluoro-6-methoxyphenylboronic acid Chemical Properties |
| Melting point | 120-125 °C (lit.) | | Boiling point | 303.1±52.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.35±0.58(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C7H8BFO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4,10-11H,1H3 | | InChIKey | XOVMDVZAWWQSDC-UHFFFAOYSA-N | | SMILES | B(C1=C(OC)C=CC=C1F)(O)O | | CAS DataBase Reference | 78495-63-3(CAS DataBase Reference) |
| | 2-Fluoro-6-methoxyphenylboronic acid Usage And Synthesis |
| Preparation | Under effective stirring, a suspension of reduced iron powder (50 mmol) in 80 mL of ethanol was added to concentrated hydrochloric acid (5 mmol), heated at 65 °C for 0.5 h, and then cooled to 55–60 °C over 10 min. Then, 8 mL of 25% ammonium chloride aqueous solution was added. Substituted 4-bromo-nitronaphthalene (10 mmol) was added in portions (exothermic) while maintaining the internal temperature at 65–80 °C. The mixture was stirred at 55–65 °C for another 1–3 h and cooled to 40 °C. Diatomaceous earth was added, and the mixture was filtered through a diatomaceous earth mat. The filter cake was washed with dichloromethane (20 mL), and the liquid phase was extracted with dichloromethane. The organic phase was dried over sodium sulfate and concentrated under reduced pressure to obtain the desired 4-bromo-1-naphthylamine. | | Uses | Reactant for:• ;Preparation of functionally selective allosteric modulators of GABAA receptors1• ;Suzuki cross-coupling reaction2,3• ;Preparation of inhibitors of the checkpoint kinase Wee14 | | Uses | suzuki reaction | | Uses | 2-Fluoro-6-methoxyphenylboronic Acid is a boronic acid derivative known for its pharmacological activity and utility as intermediates in the synthesis of novel non-boron containing compounds, and potential bacterial mutagens. |
| | 2-Fluoro-6-methoxyphenylboronic acid Preparation Products And Raw materials |
|