|
|
| | 3-(Trifluoromethyl)benzenesulfonyl chloride Basic information |
| | 3-(Trifluoromethyl)benzenesulfonyl chloride Chemical Properties |
| Melting point | 90-92 °C | | Boiling point | 88-90 °C6 mm Hg(lit.) | | density | 1.526 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.485(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Liquid | | color | Clear pale yellow to brown | | Sensitive | Moisture Sensitive | | BRN | 2650774 | | InChI | 1S/C7H4ClF3O2S/c8-14(12,13)6-3-1-2-5(4-6)7(9,10)11/h1-4H | | InChIKey | ONCAZCNPWWQQMW-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cccc(c1)S(Cl)(=O)=O | | CAS DataBase Reference | 777-44-6(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-25 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 3-(Trifluoromethyl)benzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | clear pale yellow to brown liquid | | Uses | 3-(Trifluoromethyl)benzenesulfonyl chloride can be used as a trifluoromethylating agent for the fluoroalkylation of heterocycles, aromatics, and heteroaromatics.
|
| | 3-(Trifluoromethyl)benzenesulfonyl chloride Preparation Products And Raw materials |
|