- TmPyPB
-
-
2026-05-19
- CAS:921205-03-0
- Min. Order: 1g
- Purity: 99.5%
- Supply Ability: 100kgs
|
| | 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Basic information |
| Product Name: | 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine | | Synonyms: | 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine;1,3,5-tri[(3-pyridyl)-phen-3-yl]benzene;TMPyPB , 1,3,5-Tri(M-pyrid-3-yl-phenyl)benzene;3,3'-(5'-(3-(pyridin-3-yl)phenyl)-[1,1':3',1''-terphenyl]-3,3''-diyl)dipyridine;TM3PyPB;1,3,5-tri[(3-pyridyl)-phen-3-yl]benzene/TMPyPB;TMPyPB, 1,3,5-tri[(3-pyridyl)-phen-3-yl]benzene;TmPyPB 99% (HPLC) | | CAS: | 921205-03-0 | | MF: | C39H27N3 | | MW: | 537.65 | | EINECS: | 1312995-182-4 | | Product Categories: | OLED | | Mol File: | 921205-03-0.mol | ![3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Structure](CAS2/GIF/921205-03-0.gif) |
| | 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Chemical Properties |
| Melting point | 195-200°C | | Boiling point | 748.9±55.0 °C(Predicted) | | density | 1.166 | | storage temp. | 2-8°C | | solubility | chloroform: soluble dichloromethane: soluble | | form | powder | | pka | 5.02±0.11(Predicted) | | InChI | 1S/C39H27N3/c1-7-28(34-13-4-16-40-25-34)19-31(10-1)37-22-38(32-11-2-8-29(20-32)35-14-5-17-41-26-35)24-39(23-37)33-12-3-9-30(21-33)36-15-6-18-42-27-36/h1-27H | | InChIKey | CINYXYWQPZSTOT-UHFFFAOYSA-N | | SMILES | C1(C2=CC(C3=CC=CC(C4=CC=CN=C4)=C3)=CC(C3=CC=CC(C4=CC=CN=C4)=C3)=C2)=CC=CC(C2=CC=CN=C2)=C1 | | color | White powder/crystals | | Absorption | λmax254 nm in DCM |
| WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Usage And Synthesis |
| Description | With a low-lying HOMO, high triplet energy level, and electron-deficient pyridine groups, TmPyPB is widely used as an electron-transport layer and hole-blocking layer material in organic electronic devices (such as OLEDs, OPV and perovskite solar cells). | | Uses | Electron-transport and hole/exciton-blocking materail with high electron mobility (10-4-10-3cm2V-1s-1) and high triplet energy level (2.75 eV) for highly efficient phosphorescent OLEDs application. |
| | 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Preparation Products And Raw materials |
|