|
|
| | 4-bromo-5-methyl-2-nitroaniline Basic information |
| Product Name: | 4-bromo-5-methyl-2-nitroaniline | | Synonyms: | 4-bromo-5-methyl-2-nitroaniline;4-broMo-5-Methyl-2-nitrobenzenaMine;BenzenaMine, 4-broMo-5-Methyl-2-nitro-;4-Bromo-5-methyl-2-nitro-phenylamine;4-bromo-5-methyl-2-nitroaniline ISO 9001：2015 REACH;2-Nitro-4-Bromo-5-methylaniline | | CAS: | 827-32-7 | | MF: | C7H7BrN2O2 | | MW: | 231.05 | | EINECS: | | | Product Categories: | | | Mol File: | 827-32-7.mol |  |
| | 4-bromo-5-methyl-2-nitroaniline Chemical Properties |
| Boiling point | 335.2±37.0 °C(Predicted) | | density | 1.689 | | storage temp. | 2-8°C, protect from light | | pka | -0.80±0.25(Predicted) | | form | powder | | color | Orange | | InChI | InChI=1S/C7H7BrN2O2/c1-4-2-6(9)7(10(11)12)3-5(4)8/h2-3H,9H2,1H3 | | InChIKey | POWJQZRBSYOVIJ-UHFFFAOYSA-N | | SMILES | C1(N)=CC(C)=C(Br)C=C1[N+]([O-])=O |
| WGK Germany | WGK 3 | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids |
| | 4-bromo-5-methyl-2-nitroaniline Usage And Synthesis |
| | 4-bromo-5-methyl-2-nitroaniline Preparation Products And Raw materials |
|