| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1,1-Dichloropropane Basic information |
| | 1,1-Dichloropropane Chemical Properties |
| Melting point | -83.56°C (estimate) | | Boiling point | 88 °C (lit.) | | density | 1.13 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4275(lit.) | | Fp | 45 °F | | solubility | organic solvents: soluble(lit.) | | form | liquid | | Water Solubility | organic solvents: soluble(lit.) water: very slightly soluble(lit.) | | Merck | 13,7953 | | Henry's Law Constant | 2.6×10-3 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | InChI | InChI=1S/C3H6Cl2/c1-2-3(4)5/h3H,2H2,1H3 | | InChIKey | WIHMGGWNMISDNJ-UHFFFAOYSA-N | | SMILES | C(Cl)(Cl)CC | | CAS DataBase Reference | 78-99-9 | | EPA Substance Registry System | 1,1-Dichloropropane (78-99-9) |
| Hazard Codes | F,Xn | | Risk Statements | 20/21/22-36/37/38-40-11 | | Safety Statements | 16-26-36/37/39-45 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | RTECS | TX9450000 | | HazardClass | 3.1 | | PackingGroup | II | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation Carc. 2 Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 | | Hazardous Substances Data | 78-99-9(Hazardous Substances Data) | | Toxicity | LD50 orally in rats: 6.5 g/kg (Smyth et al.) |
| | 1,1-Dichloropropane Usage And Synthesis |
| Uses | 1,1-Dichloropropane was used in the synthesis of chloropropenes by undergoing flash vacuum pyrolysis over magnesium. | | General Description | Colorless watery liquid with a sweet odor. Sinks in water. Produces irritating vapor. | | Air & Water Reactions | Highly flammable. | | Reactivity Profile | Halogenated aliphatic compounds, such as 1,1-DICHLOROPROPANE, are moderately or very reactive. Reactivity generally decreases with increased degree of substitution of halogen for hydrogen atoms. Low molecular weight haloalkanes are highly flammable and can react with some metals to form dangerous products. Materials in this group are incompatible with strong oxidizing and reducing agents. Also, they are incompatible with many amines, nitrides, azo/diazo compounds, alkali metals, and epoxides. | | Health Hazard | INHALATION: May cause some central nervous system depression. EYES: May cause some pain and irritation. SKIN: Mild irritation. | | Fire Hazard | Special Hazards of Combustion Products: Emits fumes of phosgene |
| | 1,1-Dichloropropane Preparation Products And Raw materials |
|