|
|
| | 4-[Bis(4-methoxyphenyl)amino]benzaldehyde Basic information |
| Product Name: | 4-[Bis(4-methoxyphenyl)amino]benzaldehyde | | Synonyms: | 4-[Bis(4-methoxyphenyl)amino]benzaldehyde;4-(4-methoxy-N-(4-methoxyphenyl)anilino)benzaldehyde;4-[Bis(4-methoxyphenyl)amino]benzaldehyde>Benzaldehyde, 4-[bis(4-methoxyphenyl)amino]-;4-Formyl-4',4''-dimethoxytriphenylamine;4-(bis(4-methoxyphenyl)methylamino)benzaldehyde | | CAS: | 89115-20-8 | | MF: | C21H19NO3 | | MW: | 333.38 | | EINECS: | | | Product Categories: | | | Mol File: | 89115-20-8.mol | ![4-[Bis(4-methoxyphenyl)amino]benzaldehyde Structure](CAS2/GIF/89115-20-8.gif) |
| | 4-[Bis(4-methoxyphenyl)amino]benzaldehyde Chemical Properties |
| Melting point | 99.0 to 104.0 °C | | Boiling point | 505.4±45.0 °C(Predicted) | | density | 1.189 | | storage temp. | 2-8°C, stored under nitrogen | | pka | -4.31±0.50(Predicted) | | form | powder to crystal | | color | White to Yellow to Green | | InChI | InChI=1S/C21H19NO3/c1-24-20-11-7-18(8-12-20)22(17-5-3-16(15-23)4-6-17)19-9-13-21(25-2)14-10-19/h3-15H,1-2H3 | | InChIKey | CTRXZOLNEVJBDX-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(N(C2=CC=C(OC)C=C2)C2=CC=C(OC)C=C2)C=C1 | | CAS DataBase Reference | 89115-20-8 |
| | 4-[Bis(4-methoxyphenyl)amino]benzaldehyde Usage And Synthesis |
| | 4-[Bis(4-methoxyphenyl)amino]benzaldehyde Preparation Products And Raw materials |
|