|
|
| | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- Basic information |
| Product Name: | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- | | Synonyms: | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)-;Tris(4-methoxyphenyl)amine;4-methoxy-N,N-bis(4-methoxyphenyl)aniline;4-methoxy-N,N-bis(4-methoxyphenyl)benzenemethylamine;4-Methoxy-N,N-bis(4-methoxyphenyl)benzenamine | | CAS: | 13050-56-1 | | MF: | C21H21NO3 | | MW: | 335.4 | | EINECS: | | | Product Categories: | | | Mol File: | 13050-56-1.mol |  |
| | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- Chemical Properties |
| storage temp. | 2-8°C, protect from light | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C21H21NO3/c1-23-19-10-4-16(5-11-19)22(17-6-12-20(24-2)13-7-17)18-8-14-21(25-3)15-9-18/h4-15H,1-3H3 | | InChIKey | AMLOAIZZHUTCIJ-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=C(OC)C=C2)C2=CC=C(OC)C=C2)=CC=C(OC)C=C1 |
| | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- Usage And Synthesis |
| Uses | Tris(4-methoxyphenyl)amine acts as a mediator in dye-sensitized solar cells. |
| | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- Preparation Products And Raw materials |
|