|
|
| | 3,6-dichlorobenzene-1,2,4-tricarboxylic acid Basic information |
| Product Name: | 3,6-dichlorobenzene-1,2,4-tricarboxylic acid | | Synonyms: | 2,5-Dichloro1,3,4-trimellitic acid;2,5-Dichloro-1,3,4-benzenetricarboxylic acid;3,6-dichlorobenzene-1,2,4-tricarboxylic acid;3,6-Dichlorotrimellitic acid;1,2,4-Benzenetricarboxylic acid, 3,6-dichloro-;3,6-Dichlorobenzene-1,2,4-tricarboxylic anhydride [3,6-Dichlorotrimellitic anhydride];3,6-Dichloro-1,2,4-benzenetricarboxylic
Acid;3,6Dichlorotrimellitic acid,3,6 Dichlorotrimellitic acid,Inhibitor,inhibit,3,6-Dichlorotrimellitic acid | | CAS: | 137071-78-4 | | MF: | C9H4Cl2O6 | | MW: | 279.03 | | EINECS: | | | Product Categories: | | | Mol File: | 137071-78-4.mol |  |
| | 3,6-dichlorobenzene-1,2,4-tricarboxylic acid Chemical Properties |
| Boiling point | 487.7±45.0 °C(Predicted) | | density | 1.848 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol; Ethyl Acetate | | pka | 1.07±0.25(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C9H4Cl2O6/c10-3-1-2(7(12)13)6(11)5(9(16)17)4(3)8(14)15/h1H,(H,12,13)(H,14,15)(H,16,17) | | InChIKey | WFLALXNBVTWGKP-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=C(Cl)C=C(C(O)=O)C(Cl)=C1C(O)=O |
| | 3,6-dichlorobenzene-1,2,4-tricarboxylic acid Usage And Synthesis |
| Uses | 3,6-Dichlorotrimellitic acid is the key precursor that is used for preparing a variety of dichlorinated fluoresceins and rhodamines such as TET and HEX. These chlorinated fluoresceins and rhodamines are widely used for labeling oligos and in DNA sequencing. |
| | 3,6-dichlorobenzene-1,2,4-tricarboxylic acid Preparation Products And Raw materials |
|