|
|
| | 2,2',4,4',6,6'-Hexabromobiphenyl Basic information |
| Product Name: | 2,2',4,4',6,6'-Hexabromobiphenyl | | Synonyms: | PBB NO 155;pbb 155;1,1'-Biphenyl, 2,2',4,4',6,6'-hexabromo-;2,2',4,4',6,6'-hexabromo-1,1'-biphenyl;2,2',4,4',6,6'-Hexabromobiphenyl;HexaBr PBB 2.2`.4.4`.6.6`-Hexabromobiphenyl;C21015500 PBB-No. 155 | | CAS: | 59261-08-4 | | MF: | C12H4Br6 | | MW: | 627.58 | | EINECS: | | | Product Categories: | | | Mol File: | 59261-08-4.mol |  |
| | 2,2',4,4',6,6'-Hexabromobiphenyl Chemical Properties |
| Melting point | 179-180 °C(Solv: hexane (110-54-3)) | | Boiling point | 458.3±40.0 °C(Predicted) | | density | 2.492±0.06 g/cm3(Predicted) | | solubility | Chloroform (Slightly) | | form | Solid | | color | White | | InChI | InChI=1S/C12H4Br6/c13-5-1-7(15)11(8(16)2-5)12-9(17)3-6(14)4-10(12)18/h1-4H | | InChIKey | LNFYSRMCCKKDEH-UHFFFAOYSA-N | | SMILES | C1(C2=C(Br)C=C(Br)C=C2Br)=C(Br)C=C(Br)C=C1Br | | EPA Substance Registry System | PBB 155 (59261-08-4) |
| | 2,2',4,4',6,6'-Hexabromobiphenyl Usage And Synthesis |
| Uses | PBB 155 is a related compound of PBB 37 (P215150), a brominated biphenyls that can be used as a flame retardant and often incorporated into consumer products including appliances, electronics and plastics. |
| | 2,2',4,4',6,6'-Hexabromobiphenyl Preparation Products And Raw materials |
|