- 2,4,6-tribromotoluene
-
- $20.00 / 1KG
-
2026-03-23
- CAS:6320-40-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 20 tons
- 2,4,6-TRIBROMOTOLUENE
-
- $100.00 / 1KG
-
2025-09-25
- CAS:6320-40-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- ,4,6-TRIBROMOTOLUENE
-
- $1.00 / 1kg
-
2019-07-06
- CAS:6320-40-7
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: as request
|
| | 2,4,6-TRIBROMOTOLUENE Basic information |
| Product Name: | 2,4,6-TRIBROMOTOLUENE | | Synonyms: | 2,4,6-TRIBROMOTOLUENE;2-Methyl-1,3,5-tribromoben;Benzene, 1,3,5-tribromo-2-methyl-;2,4,6-Tribromotoluene 98%;1,3,5-Tribromo-2-methylbenzene;2,4,6-Tribromotoluene,97%;Einecs 228-672-2;2-Methyl-1,3,5-tribromobenzene | | CAS: | 6320-40-7 | | MF: | C7H5Br3 | | MW: | 328.83 | | EINECS: | 228-672-2 | | Product Categories: | Aromatic Hydrocarbons (substituted) & Derivatives | | Mol File: | 6320-40-7.mol |  |
| | 2,4,6-TRIBROMOTOLUENE Chemical Properties |
| Melting point | 68-71 °C(lit.) | | Boiling point | 290°C | | density | 2,479 g/cm3 | | refractive index | 1.6340 (estimate) | | Fp | 290°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Powder and/or Chunks | | color | Yellow to light brown | | Water Solubility | Insoluble in water. | | BRN | 2359313 | | InChI | InChI=1S/C7H5Br3/c1-4-6(9)2-5(8)3-7(4)10/h2-3H,1H3 | | InChIKey | BFRIZWKDNUHPHL-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(Br)=CC(Br)=C1C | | CAS DataBase Reference | 6320-40-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29039990 |
| | 2,4,6-TRIBROMOTOLUENE Usage And Synthesis |
| Chemical Properties | Yellow powder | | Uses | 2,4,6-Tribromotoluene acts as a reagent in the synthesis of non-proteinogenic α-amino acids. |
| | 2,4,6-TRIBROMOTOLUENE Preparation Products And Raw materials |
| Raw materials | Benzene, 1,2,4,5-tetrabromo-3-methyl-6-nitro--->3,5-DIBROMO-4-METHYLANILINE-->3-METHYL-2,4,6-TRIBROMOANILINE-->m-Toluidine | | Preparation Products | 2,4,6-TRIBROMOBENZOIC ACID-->2,4,5-TRIBROMOTOLUENE-->2,3,4,5,6-PENTABROMOTOLUENE-->Benzene, 1,3,5-tribromo-2-(dibromomethyl)- |
|