| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | N,N'-Desethylene-N,N'-diforMyl Levofloxacin Basic information |
| | N,N'-Desethylene-N,N'-diforMyl Levofloxacin Chemical Properties |
| Melting point | 179-181°C | | Boiling point | 708.6±60.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | | form | Solid | | pka | 5.02±0.40(Predicted) | | color | Off-White to Tan | | InChI | InChI=1S/C18H18FN3O6/c1-10-7-28-17-14-11(16(25)12(18(26)27)6-22(10)14)5-13(19)15(17)21(9-24)4-3-20(2)8-23/h5-6,8-10H,3-4,7H2,1-2H3,(H,26,27)/t10-/m0/s1 | | InChIKey | HTOKHJLTWLBPPN-JTQLQIEISA-N | | SMILES | O1C2=C(N(C=O)CCN(C=O)C)C(F)=CC3C(=O)C(C(O)=O)=CN(C2=3)[C@@H](C)C1 |
| | N,N'-Desethylene-N,N'-diforMyl Levofloxacin Usage And Synthesis |
| Chemical Properties | Tan Solid | | Uses | Levofloxacin (L360000) impurity. A photodegradation product of Levofloxacin (L360000) in aqueous solution. |
| | N,N'-Desethylene-N,N'-diforMyl Levofloxacin Preparation Products And Raw materials |
|