| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | N3-PEG6-tBu Basic information |
| Product Name: | N3-PEG6-tBu | | Synonyms: | N3-PEG6-tBu;N3-PEG6-CH2CH2COOtBu;21-Azido-4,7,10,13,16,19-hexaoxaheneicosanoic acid 1,1-dimethylethyl ester;Azido-PEG7-t-butly ester;Azido-PEG7-t-butyl ester;N3-PEG6-CH2CH2COOtBu;Azido-PEG6-COOtBu;Azido-PEG6-C2-Boc | | CAS: | 406213-76-1 | | MF: | C19H37N3O8 | | MW: | 435.51238 | | EINECS: | | | Product Categories: | peg | | Mol File: | 406213-76-1.mol |  |
| | N3-PEG6-tBu Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C19H37N3O8/c1-19(2,3)30-18(23)4-6-24-8-10-26-12-14-28-16-17-29-15-13-27-11-9-25-7-5-21-22-20/h4-17H2,1-3H3 | | InChIKey | HRNUWAOLFSWRDG-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| | N3-PEG6-tBu Usage And Synthesis |
| Description | Azido-PEG6-t-butyl ester is a PEG molecule consisting of an azide group and a t-butyl ester moiety. he azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The t-butyl protected carboxyl group can be deprotected under acidic conditions. The hydrophilic PEG5 spacer increases solubility in aqueous media. | | Uses | Azido-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG6-C2-Boc is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | IC 50 | PEGs; Alkyl/ether | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | N3-PEG6-tBu Preparation Products And Raw materials |
|