| Company Name: |
LAURENT.INC Gold |
| Tel: |
19210627729 |
| Email: |
sun@laurentpeg.com |
|
| | Octaethylene Glycol Monomethyl Ether Basic information |
| | Octaethylene Glycol Monomethyl Ether Chemical Properties |
| Boiling point | 216 °C / 2mmHg | | density | 1.09 | | refractive index | 1.4560 to 1.4600 | | storage temp. | 2-8°C | | pka | 14.36±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C17H36O9/c1-19-4-5-21-8-9-23-12-13-25-16-17-26-15-14-24-11-10-22-7-6-20-3-2-18/h18H,2-17H2,1H3 | | InChIKey | SZGNWRSFHADOMY-UHFFFAOYSA-N | | SMILES | C(O)COCCOCCOCCOCCOCCOCCOCCOC |
| | Octaethylene Glycol Monomethyl Ether Usage And Synthesis |
| Description | m-PEG8-alcohol is a PEG linker containing a hydroxyl group. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | Octaethylene glycol monomethyl ether is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | | IC 50 | PEGs |
| | Octaethylene Glycol Monomethyl Ether Preparation Products And Raw materials |
|