- (S)-Tenofovir
-
- $29.00
-
2026-07-27
- CAS:147127-19-3
- Purity: 99.90%
- Supply Ability: 10g
- (S)-Tenofovir
-
- $29.00
-
2026-07-27
- CAS:147127-19-3
- Purity: 99.90%
- Supply Ability: 10g
- (S)-Tenofovir
-
-
2026-06-30
- CAS:147127-19-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | (S)-Tenofovir Basic information |
| Product Name: | (S)-Tenofovir | | Synonyms: | (S)-PMPA;(S)-(1-(6-aMino-9H-purin-9-yl)propan-2-yloxy)Methylphosphonic acid;(S)-Tenofovir;[(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;3-O-BENZYL-4-(HYDROXYMETHYL-1,2-O-ISOPROPYLIDENE)--D-ERYTHROPENTOFURANOSE;Tenofovir alafenamide-23;Tenofovir impurity 45/(S)-(((1-(6-Amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphonic acid;(S)-[[[1-(6-Amino-9H-purin-9-yl)-2-propyl]oxy]methyl]phosphonic Acid | | CAS: | 147127-19-3 | | MF: | C9H14N5O4P | | MW: | 287.21 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 147127-19-3.mol |  |
| | (S)-Tenofovir Chemical Properties |
| Melting point | >260°C (dec.) | | Boiling point | 616.1±65.0 °C(Predicted) | | density | 1.79±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 2.36±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C9H14N5O4P/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14/h3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17)/t6-/m0/s1 | | InChIKey | SGOIRFVFHAKUTI-LURJTMIESA-N | | SMILES | P(CO[C@@H](C)CN1C2C(N=C1)=C(N)N=CN=2)(=O)(O)O |
| | (S)-Tenofovir Usage And Synthesis |
| Uses | (S)-Tenofovir is an S-enatiomeric derivative of Tenofovir (T018500). (S)-Tenofovir displays virucidal activity against herpes, visna virus and retrovirus. The S enantiomer of Tenofovir (T018500) is less effective against HIV than their (R)-enantiomeric counterparts. |
| | (S)-Tenofovir Preparation Products And Raw materials |
|