| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Labetalol IMpurity A Basic information |
| Product Name: | Labetalol IMpurity A | | Synonyms: | 2-Hydroxy-5-[1-hydroxy-2-[(1-Methyl-3-phenylpropyl)aMino]ethyl]benzoic Acid;5-[1-Hydroxy-2-[(1-Methyl-3-phenylpropyl)aMino]ethyl]salicylic Acid;Labetalol IMpurity A;Labetalol-1-carboxylic Acid;Labetalol EP impurity A;Benzoic acid, 2-hydroxy-5-[1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]ethyl]-;Labetalol Hydrochloride Impurity 1 (Labetalol Hydrochloride EP Impurity A);Labetalol EP Impurity A (Labetalol 1-Carboxylic Acid) | | CAS: | 1391051-99-2 | | MF: | C19H23NO4 | | MW: | 329.39 | | EINECS: | | | Product Categories: | Amines;Aromatics;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 1391051-99-2.mol |  |
| | Labetalol IMpurity A Chemical Properties |
| Melting point | >172°C (dec.) | | Boiling point | 565.9±50.0 °C(Predicted) | | density | 1.231±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | pka | 3.08±0.10(Predicted) | | form | solid | | color | Pale Beige to Light Brown | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C19H23NO4/c1-13(7-8-14-5-3-2-4-6-14)20-12-18(22)15-9-10-17(21)16(11-15)19(23)24/h2-6,9-11,13,18,20-22H,7-8,12H2,1H3,(H,23,24) | | InChIKey | DZBUYRWVQLOXQQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C(O)CNC(C)CCC2=CC=CC=C2)=CC=C1O |
| | Labetalol IMpurity A Usage And Synthesis |
| Uses | Labetalol-1-carboxylic Acid is an impurity of the α-and β-adrenergic, Labetalol (L096500). |
| | Labetalol IMpurity A Preparation Products And Raw materials |
|