| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Chlorocholine Chloride-d9 Basic information |
| | Chlorocholine Chloride-d9 Chemical Properties |
| Melting point | 239-243°C (dec.) (lit.) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C5H13ClN.ClH/c1-7(2,3)5-4-6;/h4-5H2,1-3H3;1H/q+1;/p-1/i1D3,2D3,3D3; | | InChIKey | UHZZMRAGKVHANO-KYRNGWDOSA-M | | SMILES | [Cl-].[2H]C([2H])([2H])[N+](CCCl)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 21/22 | | Safety Statements | 36/37 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 2 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral |
| | Chlorocholine Chloride-d9 Usage And Synthesis |
| Uses | Chlorocholine Chloride-d9 is a labelled analogue of Chlorocholine Chloride, a plant growth regulator that is primarily used on ornamental plants. |
| | Chlorocholine Chloride-d9 Preparation Products And Raw materials |
|