| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
AA41612 manufacturers
- AA41612
-
- $43.00
-
2026-08-04
- CAS:433690-62-1
- Purity: 99.16%
- Supply Ability: 10g
- AA41612
-
-
2026-06-30
- CAS:433690-62-1
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 20Tons
|
| | AA41612 Basic information |
| Product Name: | AA41612 | | Synonyms: | 1-[(2,5-Dichloro-4-methoxyphenyl)sulphonyl]piperidine;2,5-Dichloro-4-[(piperidin-1-yl)sulphonyl]anisole, 2,5-Dichloro-4-methoxyphenyl piperidin-1-yl sulphone;AA 41612
(AA41612);Piperidine, 1-[(2,5-dichloro-4-methoxyphenyl)sulfonyl]-;AA41612,AA-41612,Inhibitor,inhibit,AA 41612;1-(2,5-dichloro-4-methoxybenzenesulfonyl)piperidine | | CAS: | 433690-62-1 | | MF: | C12H15Cl2NO3S | | MW: | 324.22 | | EINECS: | | | Product Categories: | | | Mol File: | 433690-62-1.mol |  |
| | AA41612 Chemical Properties |
| form | Solid | | color | White to off-white | | InChI | InChI=1S/C12H15Cl2NO3S/c1-18-11-7-10(14)12(8-9(11)13)19(16,17)15-5-3-2-4-6-15/h7-8H,2-6H2,1H3 | | InChIKey | FEMVYIQDVGQFBA-UHFFFAOYSA-N | | SMILES | N1(S(C2=CC(Cl)=C(OC)C=C2Cl)(=O)=O)CCCCC1 |
| | AA41612 Usage And Synthesis |
| Uses | AA41612 is a novel antagonist of melanopsin-mediated phototransduction. |
| | AA41612 Preparation Products And Raw materials |
|