|
|
| Product Name: | CPhos | | Synonyms: | 2-Dicyclohexylphosphino-2',6'-bis(diMethylaMino)-1,1'-biphenyl, Min. 98% Cphos;2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl;Cphos;2'-(Dicyclohexylphosphino)-N2,N2,N6,N6-tetramethyl[1,1'-biphenyl]-2,6-diamine;2-DICYCLOHEXYLPHOSPHINO-2',6'-DIMETHYLAMINO-1,1'-BIPHENYL;2-Dicyclohexylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl;2-(2-dicyclohexylphosphanylphenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine;2-Dicyclohexylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl,Cphos | | CAS: | 1160556-64-8 | | MF: | C28H41N2P | | MW: | 436.61 | | EINECS: | | | Product Categories: | Indolines ,Indoles;Achiral Phosphine;Aryl Phosphine;Buchwald Ligands Series;Buchwald Ligands&Precatalysts | | Mol File: | 1160556-64-8.mol |  |
| | CPhos Chemical Properties |
| Melting point | 111-113°C | | Boiling point | 592.8±50.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 5.04±0.28(Predicted) | | form | crystal | | color | yellow-orange | | InChI | InChI=1S/C28H41N2P/c1-29(2)25-19-13-20-26(30(3)4)28(25)24-18-11-12-21-27(24)31(22-14-7-5-8-15-22)23-16-9-6-10-17-23/h11-13,18-23H,5-10,14-17H2,1-4H3 | | InChIKey | DRNAQRXLOSUHBQ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2P(C2CCCCC2)C2CCCCC2)=C(N(C)C)C=CC=C1N(C)C | | CAS DataBase Reference | 1160556-64-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | CPhos Usage And Synthesis |
| Reactions | Preparation of aryl sulfonamides via palladium-catalyzed chlorosulfonylation of arylboronic acids.
| | Description | CPhos, the full name of which is 2'-(Dicyclohexylphosphino)-N2,N2,N6,N6-tetramethyl(1,1'-biphenyl)-2,6-diamine, is a highly efficient palladium catalyst with excellent cross-coupling activity and is widely used in organic synthesis and materials science. | | Uses | CPhos, is used as a catalyst in the synthetic preparation of palladium-catalyzed Negishi coupling of secondary alkylzinc halides with aryl bromides and chlorides. | | Uses | CPhos can be used:
- As a ligand in the Pd-catalyzed synthesis of 3-cyclopentylindole derivatives, dihydrobenzofurans and trans-bicyclic sulfamides.
- To synthesize palladacycle precatalysts for Negishi coupling of secondary alkylzinc.
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand reaction type: Cross Couplings |
| | CPhos Preparation Products And Raw materials |
|